C15H25NO3 — CID 142472938
ethane;2-ethoxy-N-(2-hydroxy-2-methylpropyl)benzamide (PubChem CID 142472938) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is ethane;2-ethoxy-N-(2-hydroxy-2-methylpropyl)benzamide.
| Compound Name | ethane;2-ethoxy-N-(2-hydroxy-2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 142472938 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | ethane;2-ethoxy-N-(2-hydroxy-2-methylpropyl)benzamide |
| SMILES | CC.CCOc1ccccc1C(=O)NCC(C)(C)O |
| InChI | InChI=1S/C13H19NO3.C2H6/c1-4-17-11-8-6-5-7-10(11)12(15)14-9-13(2,3)16;1-2/h5-8,16H,4,9H2,1-3H3,(H,14,15);1-2H3 |
| InChIKey | XUVYYLMQOIJLNP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |