C16H25NO3 — CID 111446636
2-ethoxy-N-(2-hydroxy-2,3-dimethylpentyl)benzamide (PubChem CID 111446636) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-ethoxy-N-(2-hydroxy-2,3-dimethylpentyl)benzamide.
| Compound Name | 2-ethoxy-N-(2-hydroxy-2,3-dimethylpentyl)benzamide |
|---|---|
| PubChem CID | 111446636 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 2-ethoxy-N-(2-hydroxy-2,3-dimethylpentyl)benzamide |
| SMILES | CCOc1ccccc1C(=O)NCC(C)(O)C(C)CC |
| InChI | InChI=1S/C16H25NO3/c1-5-12(3)16(4,19)11-17-15(18)13-9-7-8-10-14(13)20-6-2/h7-10,12,19H,5-6,11H2,1-4H3,(H,17,18) |
| InChIKey | XWXXFBOUISZQPQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |