C16H25NO2S — CID 97350853
N-[(2S)-3,3-dimethyl-2-methylsulfanylbutyl]-2-ethoxybenzamide (PubChem CID 97350853) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is N-[(2S)-3,3-dimethyl-2-methylsulfanylbutyl]-2-ethoxybenzamide.
| Compound Name | N-[(2S)-3,3-dimethyl-2-methylsulfanylbutyl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 97350853 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-[(2S)-3,3-dimethyl-2-methylsulfanylbutyl]-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)NC[C@@H](SC)C(C)(C)C |
| InChI | InChI=1S/C16H25NO2S/c1-6-19-13-10-8-7-9-12(13)15(18)17-11-14(20-5)16(2,3)4/h7-10,14H,6,11H2,1-5H3,(H,17,18)/t14-/m1/s1 |
| InChIKey | OGFGLTOCOODWNT-CQSZACIVSA-N |
| XLogP | 3.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |