C15H17N3O2 — CID 2207652
N,N-bis(2-cyanoethyl)-2-ethoxybenzamide (PubChem CID 2207652) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-2-ethoxybenzamide.
| Compound Name | N,N-bis(2-cyanoethyl)-2-ethoxybenzamide |
|---|---|
| PubChem CID | 2207652 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)N(CCC#N)CCC#N |
| InChI | InChI=1S/C15H17N3O2/c1-2-20-14-8-4-3-7-13(14)15(19)18(11-5-9-16)12-6-10-17/h3-4,7-8H,2,5-6,11-12H2,1H3 |
| InChIKey | BPQXZAKBJFDIQX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 77.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |