C13H12ClN3O — CID 521802
2-chloro-N,N-bis(2-cyanoethyl)benzamide (PubChem CID 521802) has the molecular formula C13H12ClN3O and a molecular weight of 261.71 g/mol. Its IUPAC name is 2-chloro-N,N-bis(2-cyanoethyl)benzamide.
| Compound Name | 2-chloro-N,N-bis(2-cyanoethyl)benzamide |
|---|---|
| PubChem CID | 521802 |
| Molecular Formula | C13H12ClN3O |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-chloro-N,N-bis(2-cyanoethyl)benzamide |
| SMILES | N#CCCN(CCC#N)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C13H12ClN3O/c14-12-6-2-1-5-11(12)13(18)17(9-3-7-15)10-4-8-16/h1-2,5-6H,3-4,9-10H2 |
| InChIKey | RAJQRBVEXOUFAX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |