C16H13Cl2N3O — CID 134013348
2,3-dichloro-N-(2-cyanoethyl)-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 134013348) has the molecular formula C16H13Cl2N3O and a molecular weight of 334.21 g/mol. Its IUPAC name is 2,3-dichloro-N-(2-cyanoethyl)-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 2,3-dichloro-N-(2-cyanoethyl)-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 134013348 |
| Molecular Formula | C16H13Cl2N3O |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 2,3-dichloro-N-(2-cyanoethyl)-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | N#CCCN(Cc1cccnc1)C(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H13Cl2N3O/c17-14-6-1-5-13(15(14)18)16(22)21(9-3-7-19)11-12-4-2-8-20-10-12/h1-2,4-6,8,10H,3,9,11H2 |
| InChIKey | XCHPLCWOUXRTIH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |