C17H14BrClN4OS — CID 2377960
5-bromo-2-chloro-N-[2-cyanoethyl(pyridin-3-ylmethyl)carbamothioyl]benzamide (PubChem CID 2377960) has the molecular formula C17H14BrClN4OS and a molecular weight of 437.75 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[2-cyanoethyl(pyridin-3-ylmethyl)carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[2-cyanoethyl(pyridin-3-ylmethyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 2377960 |
| Molecular Formula | C17H14BrClN4OS |
| Molecular Weight | 437.75 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | 5-bromo-2-chloro-N-[2-cyanoethyl(pyridin-3-ylmethyl)carbamothioyl]benzamide |
| SMILES | N#CCCN(Cc1cccnc1)C(=S)NC(=O)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C17H14BrClN4OS/c18-13-4-5-15(19)14(9-13)16(24)22-17(25)23(8-2-6-20)11-12-3-1-7-21-10-12/h1,3-5,7,9-10H,2,8,11H2,(H,22,24,25) |
| InChIKey | OTMHKGKPJFOSQI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.75 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|