C15H16Cl2N4OS — CID 2375904
(1R)-2,2-dichloro-N-[2-cyanoethyl(pyridin-3-ylmethyl)carbamothioyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 2375904) has the molecular formula C15H16Cl2N4OS and a molecular weight of 371.29 g/mol. Its IUPAC name is (1R)-2,2-dichloro-N-[2-cyanoethyl(pyridin-3-ylmethyl)carbamothioyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1R)-2,2-dichloro-N-[2-cyanoethyl(pyridin-3-ylmethyl)carbamothioyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 2375904 |
| Molecular Formula | C15H16Cl2N4OS |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | (1R)-2,2-dichloro-N-[2-cyanoethyl(pyridin-3-ylmethyl)carbamothioyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | C[C@]1(C(=O)NC(=S)N(CCC#N)Cc2cccnc2)CC1(Cl)Cl |
| InChI | InChI=1S/C15H16Cl2N4OS/c1-14(10-15(14,16)17)12(22)20-13(23)21(7-3-5-18)9-11-4-2-6-19-8-11/h2,4,6,8H,3,7,9-10H2,1H3,(H,20,22,23)/t14-/m1/s1 |
| InChIKey | QSOSSPMYMQHVQZ-CQSZACIVSA-N |
| XLogP | 2.78 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|