C14H18N4O3 — CID 61183826
3-[[2-cyanoethyl(pyridin-3-ylmethyl)carbamoyl]-methylamino]propanoic acid (PubChem CID 61183826) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-[[2-cyanoethyl(pyridin-3-ylmethyl)carbamoyl]-methylamino]propanoic acid.
| Compound Name | 3-[[2-cyanoethyl(pyridin-3-ylmethyl)carbamoyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 61183826 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 3-[[2-cyanoethyl(pyridin-3-ylmethyl)carbamoyl]-methylamino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)N(CCC#N)Cc1cccnc1 |
| InChI | InChI=1S/C14H18N4O3/c1-17(9-5-13(19)20)14(21)18(8-3-6-15)11-12-4-2-7-16-10-12/h2,4,7,10H,3,5,8-9,11H2,1H3,(H,19,20) |
| InChIKey | RCBCQPQFIKKDNV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 97.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |