C13H15N3O4 — CID 60662590
2-[2-[2-cyanoethyl(pyridin-3-ylmethyl)amino]-2-oxoethoxy]acetic acid (PubChem CID 60662590) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-[2-[2-cyanoethyl(pyridin-3-ylmethyl)amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[2-cyanoethyl(pyridin-3-ylmethyl)amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 60662590 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-[2-[2-cyanoethyl(pyridin-3-ylmethyl)amino]-2-oxoethoxy]acetic acid |
| SMILES | N#CCCN(Cc1cccnc1)C(=O)COCC(=O)O |
| InChI | InChI=1S/C13H15N3O4/c14-4-2-6-16(8-11-3-1-5-15-7-11)12(17)9-20-10-13(18)19/h1,3,5,7H,2,6,8-10H2,(H,18,19) |
| InChIKey | RURKMKVNQOQOSY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |