C15H13FN4O — CID 115496717
N-(2-cyanoethyl)-6-fluoro-N-(pyridin-3-ylmethyl)pyridine-2-carboxamide (PubChem CID 115496717) has the molecular formula C15H13FN4O and a molecular weight of 284.29 g/mol. Its IUPAC name is N-(2-cyanoethyl)-6-fluoro-N-(pyridin-3-ylmethyl)pyridine-2-carboxamide.
| Compound Name | N-(2-cyanoethyl)-6-fluoro-N-(pyridin-3-ylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 115496717 |
| Molecular Formula | C15H13FN4O |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | N-(2-cyanoethyl)-6-fluoro-N-(pyridin-3-ylmethyl)pyridine-2-carboxamide |
| SMILES | N#CCCN(Cc1cccnc1)C(=O)c1cccc(F)n1 |
| InChI | InChI=1S/C15H13FN4O/c16-14-6-1-5-13(19-14)15(21)20(9-3-7-17)11-12-4-2-8-18-10-12/h1-2,4-6,8,10H,3,9,11H2 |
| InChIKey | SXTQAHBEQYSICH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|