C14H20N4O — CID 65225689
2-(aminomethyl)-N-(2-cyanoethyl)-N-(pyridin-3-ylmethyl)butanamide (PubChem CID 65225689) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(2-cyanoethyl)-N-(pyridin-3-ylmethyl)butanamide.
| Compound Name | 2-(aminomethyl)-N-(2-cyanoethyl)-N-(pyridin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 65225689 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-(aminomethyl)-N-(2-cyanoethyl)-N-(pyridin-3-ylmethyl)butanamide |
| SMILES | CCC(CN)C(=O)N(CCC#N)Cc1cccnc1 |
| InChI | InChI=1S/C14H20N4O/c1-2-13(9-16)14(19)18(8-4-6-15)11-12-5-3-7-17-10-12/h3,5,7,10,13H,2,4,8-9,11,16H2,1H3 |
| InChIKey | XUZIJSGIXCTIEE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |