C16H15FN4S — CID 2818689
1-(2-cyanoethyl)-3-(4-fluorophenyl)-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 2818689) has the molecular formula C16H15FN4S and a molecular weight of 314.39 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-3-(4-fluorophenyl)-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-(2-cyanoethyl)-3-(4-fluorophenyl)-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 2818689 |
| Molecular Formula | C16H15FN4S |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 1-(2-cyanoethyl)-3-(4-fluorophenyl)-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | N#CCCN(Cc1cccnc1)C(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H15FN4S/c17-14-4-6-15(7-5-14)20-16(22)21(10-2-8-18)12-13-3-1-9-19-11-13/h1,3-7,9,11H,2,10,12H2,(H,20,22) |
| InChIKey | WDSAKQOIEOAUHC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|