C22H23N3S — CID 4070113
3-(4-methylphenyl)-1-[(4-methylphenyl)methyl]-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 4070113) has the molecular formula C22H23N3S and a molecular weight of 361.51 g/mol. Its IUPAC name is 3-(4-methylphenyl)-1-[(4-methylphenyl)methyl]-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 3-(4-methylphenyl)-1-[(4-methylphenyl)methyl]-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4070113 |
| Molecular Formula | C22H23N3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 3-(4-methylphenyl)-1-[(4-methylphenyl)methyl]-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | Cc1ccc(CN(Cc2cccnc2)C(=S)Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H23N3S/c1-17-5-9-19(10-6-17)15-25(16-20-4-3-13-23-14-20)22(26)24-21-11-7-18(2)8-12-21/h3-14H,15-16H2,1-2H3,(H,24,26) |
| InChIKey | ZXJJXAGMILXPKJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|