C21H20ClN3OS — CID 3504371
1-benzyl-3-(3-chloro-4-methoxyphenyl)-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 3504371) has the molecular formula C21H20ClN3OS and a molecular weight of 397.93 g/mol. Its IUPAC name is 1-benzyl-3-(3-chloro-4-methoxyphenyl)-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-benzyl-3-(3-chloro-4-methoxyphenyl)-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3504371 |
| Molecular Formula | C21H20ClN3OS |
| Molecular Weight | 397.93 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 1-benzyl-3-(3-chloro-4-methoxyphenyl)-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | COc1ccc(NC(=S)N(Cc2ccccc2)Cc2cccnc2)cc1Cl |
| InChI | InChI=1S/C21H20ClN3OS/c1-26-20-10-9-18(12-19(20)22)24-21(27)25(14-16-6-3-2-4-7-16)15-17-8-5-11-23-13-17/h2-13H,14-15H2,1H3,(H,24,27) |
| InChIKey | XJBKVVNPLABTQZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.93 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|