C24H27N3O2S — CID 4080886
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-methylphenyl)-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 4080886) has the molecular formula C24H27N3O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-methylphenyl)-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-methylphenyl)-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4080886 |
| Molecular Formula | C24H27N3O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-methylphenyl)-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | COc1ccc(CCN(Cc2cccnc2)C(=S)Nc2cccc(C)c2)cc1OC |
| InChI | InChI=1S/C24H27N3O2S/c1-18-6-4-8-21(14-18)26-24(30)27(17-20-7-5-12-25-16-20)13-11-19-9-10-22(28-2)23(15-19)29-3/h4-10,12,14-16H,11,13,17H2,1-3H3,(H,26,30) |
| InChIKey | YNZZSAZHYDUNLH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|