C24H27N3O3S — CID 4164400
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-methoxyphenyl)-1-(pyridin-2-ylmethyl)thiourea (PubChem CID 4164400) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-methoxyphenyl)-1-(pyridin-2-ylmethyl)thiourea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-methoxyphenyl)-1-(pyridin-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4164400 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-methoxyphenyl)-1-(pyridin-2-ylmethyl)thiourea |
| SMILES | COc1cccc(NC(=S)N(CCc2ccc(OC)c(OC)c2)Cc2ccccn2)c1 |
| InChI | InChI=1S/C24H27N3O3S/c1-28-21-9-6-8-19(16-21)26-24(31)27(17-20-7-4-5-13-25-20)14-12-18-10-11-22(29-2)23(15-18)30-3/h4-11,13,15-16H,12,14,17H2,1-3H3,(H,26,31) |
| InChIKey | KZZMZAKQUIPXGW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|