C23H23N3O3S — CID 4281244
1-(1,3-benzodioxol-5-ylmethyl)-3-(4-methoxy-3-methylphenyl)-1-(pyridin-2-ylmethyl)thiourea (PubChem CID 4281244) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-(4-methoxy-3-methylphenyl)-1-(pyridin-2-ylmethyl)thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(4-methoxy-3-methylphenyl)-1-(pyridin-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4281244 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(4-methoxy-3-methylphenyl)-1-(pyridin-2-ylmethyl)thiourea |
| SMILES | COc1ccc(NC(=S)N(Cc2ccc3c(c2)OCO3)Cc2ccccn2)cc1C |
| InChI | InChI=1S/C23H23N3O3S/c1-16-11-18(7-9-20(16)27-2)25-23(30)26(14-19-5-3-4-10-24-19)13-17-6-8-21-22(12-17)29-15-28-21/h3-12H,13-15H2,1-2H3,(H,25,30) |
| InChIKey | CNDKBIMHBOIBIB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|