C23H22N2O3S — CID 3645844
1-(1,3-benzodioxol-5-ylmethyl)-1-benzyl-3-(3-methoxyphenyl)thiourea (PubChem CID 3645844) has the molecular formula C23H22N2O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-1-benzyl-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-benzyl-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 3645844 |
| Molecular Formula | C23H22N2O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-benzyl-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)N(Cc2ccccc2)Cc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C23H22N2O3S/c1-26-20-9-5-8-19(13-20)24-23(29)25(14-17-6-3-2-4-7-17)15-18-10-11-21-22(12-18)28-16-27-21/h2-13H,14-16H2,1H3,(H,24,29) |
| InChIKey | RKZHLTDUCCVADW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|