C23H22N2O4 — CID 1061580
1-(1,3-benzodioxol-5-ylmethyl)-1-benzyl-3-(4-methoxyphenyl)urea (PubChem CID 1061580) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-1-benzyl-3-(4-methoxyphenyl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-benzyl-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 1061580 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-benzyl-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)N(Cc2ccccc2)Cc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C23H22N2O4/c1-27-20-10-8-19(9-11-20)24-23(26)25(14-17-5-3-2-4-6-17)15-18-7-12-21-22(13-18)29-16-28-21/h2-13H,14-16H2,1H3,(H,24,26) |
| InChIKey | GHZZUJVOYFZEBY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |