C18H20N2O4 — CID 51328316
1-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(3-methoxyphenyl)urea (PubChem CID 51328316) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(3-methoxyphenyl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 51328316 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(3-methoxyphenyl)urea |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C18H20N2O4/c1-3-20(11-13-7-8-16-17(9-13)24-12-23-16)18(21)19-14-5-4-6-15(10-14)22-2/h4-10H,3,11-12H2,1-2H3,(H,19,21) |
| InChIKey | IGEXMGJWKHICQK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |