C21H24N2O3S2 — CID 55698763
1-(1,3-benzodioxol-5-ylmethyl)-3-[3-(1,3-dithian-2-yl)phenyl]-1-ethylurea (PubChem CID 55698763) has the molecular formula C21H24N2O3S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[3-(1,3-dithian-2-yl)phenyl]-1-ethylurea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[3-(1,3-dithian-2-yl)phenyl]-1-ethylurea |
|---|---|
| PubChem CID | 55698763 |
| Molecular Formula | C21H24N2O3S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[3-(1,3-dithian-2-yl)phenyl]-1-ethylurea |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)Nc1cccc(C2SCCCS2)c1 |
| InChI | InChI=1S/C21H24N2O3S2/c1-2-23(13-15-7-8-18-19(11-15)26-14-25-18)21(24)22-17-6-3-5-16(12-17)20-27-9-4-10-28-20/h3,5-8,11-12,20H,2,4,9-10,13-14H2,1H3,(H,22,24) |
| InChIKey | SGJNYSUBMZCDTL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |