C21H21N3O5S — CID 56566361
1-(1,3-benzodioxol-5-ylmethyl)-3-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-1-ethylurea (PubChem CID 56566361) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-1-ethylurea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-1-ethylurea |
|---|---|
| PubChem CID | 56566361 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-1-ethylurea |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)Nc1ccc(CN2C(=O)CSC2=O)cc1 |
| InChI | InChI=1S/C21H21N3O5S/c1-2-23(10-15-5-8-17-18(9-15)29-13-28-17)20(26)22-16-6-3-14(4-7-16)11-24-19(25)12-30-21(24)27/h3-9H,2,10-13H2,1H3,(H,22,26) |
| InChIKey | CCSHRGXMBWKQOU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|