C13H16ClNO3 — CID 54874683
N-(1,3-benzodioxol-5-ylmethyl)-3-chloro-N-ethylpropanamide (PubChem CID 54874683) has the molecular formula C13H16ClNO3 and a molecular weight of 269.73 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-chloro-N-ethylpropanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-chloro-N-ethylpropanamide |
|---|---|
| PubChem CID | 54874683 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-chloro-N-ethylpropanamide |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)CCCl |
| InChI | InChI=1S/C13H16ClNO3/c1-2-15(13(16)5-6-14)8-10-3-4-11-12(7-10)18-9-17-11/h3-4,7H,2,5-6,8-9H2,1H3 |
| InChIKey | DXAVAUGHIQLLRX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|