C14H18ClNO3 — CID 39384116
N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-(2-methylpropyl)acetamide (PubChem CID 39384116) has the molecular formula C14H18ClNO3 and a molecular weight of 283.76 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-(2-methylpropyl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 39384116 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-(2-methylpropyl)acetamide |
| SMILES | CC(C)CN(Cc1ccc2c(c1)OCO2)C(=O)CCl |
| InChI | InChI=1S/C14H18ClNO3/c1-10(2)7-16(14(17)6-15)8-11-3-4-12-13(5-11)19-9-18-12/h3-5,10H,6-9H2,1-2H3 |
| InChIKey | LERWXKFQMKHFMS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|