C16H23NO3 — CID 4668559
N,N-bis(2-methylpropyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 4668559) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is N,N-bis(2-methylpropyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N,N-bis(2-methylpropyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 4668559 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | N,N-bis(2-methylpropyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H23NO3/c1-11(2)8-17(9-12(3)4)16(18)13-5-6-14-15(7-13)20-10-19-14/h5-7,11-12H,8-10H2,1-4H3 |
| InChIKey | KGWPCGRQSBHBOW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |