C10H10ClNO3 — CID 10331338
N-(chloromethyl)-N-methyl-1,3-benzodioxole-5-carboxamide (PubChem CID 10331338) has the molecular formula C10H10ClNO3 and a molecular weight of 227.65 g/mol. Its IUPAC name is N-(chloromethyl)-N-methyl-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(chloromethyl)-N-methyl-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 10331338 |
| Molecular Formula | C10H10ClNO3 |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | N-(chloromethyl)-N-methyl-1,3-benzodioxole-5-carboxamide |
| SMILES | CN(CCl)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H10ClNO3/c1-12(5-11)10(13)7-2-3-8-9(4-7)15-6-14-8/h2-4H,5-6H2,1H3 |
| InChIKey | ZAPRZNVKAARDMI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|