4-[1,3-benzodioxole-5-carbonyl(methyl)amino]butanoic acid

C13H15NO5 — CID 43090104

IUPAC4-[1,3-benzodioxole-5-carbonyl(methyl)amino]butanoic acid
SMILESCN(CCCC(=O)O)C(=O)c1ccc2c(c1)OCO2
InChIInChI=1S/C13H15NO5/c1-14(6-2-3-12(15)16)13(17)9-4-5-10-11(7-9)19-8-18-10/h4-5,7H,2-3,6,8H2,1H3,(H,15,16)
InChIKeyZZYXDHPCXNHXEQ-UHFFFAOYSA-N
MW265.26 g/mol
LogP1.35
Rot. Bonds5

About 4-[1,3-benzodioxole-5-carbonyl(methyl)amino]butanoic acid

4-[1,3-benzodioxole-5-carbonyl(methyl)amino]butanoic acid (PubChem CID 43090104) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is 4-[1,3-benzodioxole-5-carbonyl(methyl)amino]butanoic acid.

Molecular Properties

Compound Name4-[1,3-benzodioxole-5-carbonyl(methyl)amino]butanoic acid
PubChem CID43090104
Molecular FormulaC13H15NO5
Molecular Weight265.26 g/mol
Exact Mass265.10
IUPAC Name4-[1,3-benzodioxole-5-carbonyl(methyl)amino]butanoic acid
SMILESCN(CCCC(=O)O)C(=O)c1ccc2c(c1)OCO2
InChIInChI=1S/C13H15NO5/c1-14(6-2-3-12(15)16)13(17)9-4-5-10-11(7-9)19-8-18-10/h4-5,7H,2-3,6,8H2,1H3,(H,15,16)
InChIKeyZZYXDHPCXNHXEQ-UHFFFAOYSA-N
XLogP1.35
TPSA76.07 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.26
LogP ≤ 51.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-[1,3-benzodioxole-5-carbonyl(methyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[1,3-benzodioxole-5-carbonyl(methyl)amino]butanoic acid?
The IUPAC name of 4-[1,3-benzodioxole-5-carbonyl(methyl)amino]butanoic acid (CID 43090104) is 4-[1,3-benzodioxole-5-carbonyl(methyl)amino]butanoic acid.
What is the SMILES notation for 4-[1,3-benzodioxole-5-carbonyl(methyl)amino]butanoic acid?
The canonical SMILES for 4-[1,3-benzodioxole-5-carbonyl(methyl)amino]butanoic acid is CN(CCCC(=O)O)C(=O)c1ccc2c(c1)OCO2.
What is the InChIKey of 4-[1,3-benzodioxole-5-carbonyl(methyl)amino]butanoic acid?
The InChIKey is ZZYXDHPCXNHXEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO5/c1-14(6-2-3-12(15)16)13(17)9-4-5-10-11(7-9)19-8-18-10/h4-5,7H,2-3,6,8H2,1H3,(H,15,16).
What are the key properties of 4-[1,3-benzodioxole-5-carbonyl(methyl)amino]butanoic acid?
4-[1,3-benzodioxole-5-carbonyl(methyl)amino]butanoic acid has a molecular weight of 265.26 g/mol, XLogP of 1.35, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1,3-benzodioxole-5-carbonyl(methyl)amino]butanoic acid is sourced from PubChem (CID 43090104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).