C17H21NO6 — CID 168989865
7-[[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]-methylamino]-7-oxoheptanoic acid (PubChem CID 168989865) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is 7-[[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]-methylamino]-7-oxoheptanoic acid.
| Compound Name | 7-[[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]-methylamino]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 168989865 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 7-[[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]-methylamino]-7-oxoheptanoic acid |
| SMILES | CN(CC(=O)c1ccc2c(c1)OCO2)C(=O)CCCCCC(=O)O |
| InChI | InChI=1S/C17H21NO6/c1-18(16(20)5-3-2-4-6-17(21)22)10-13(19)12-7-8-14-15(9-12)24-11-23-14/h7-9H,2-6,10-11H2,1H3,(H,21,22) |
| InChIKey | UBEIMHUFCQQFNW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|