C40H56O12 — CID 14930644
10-[25-(9-carboxynonanoyl)-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]-10-oxodecanoic acid (PubChem CID 14930644) has the molecular formula C40H56O12 and a molecular weight of 728.88 g/mol. Its IUPAC name is 10-[25-(9-carboxynonanoyl)-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]-10-oxodecanoic acid.
| Compound Name | 10-[25-(9-carboxynonanoyl)-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]-10-oxodecanoic acid |
|---|---|
| PubChem CID | 14930644 |
| Molecular Formula | C40H56O12 |
| Molecular Weight | 728.88 g/mol |
| Exact Mass | 728.38 |
| IUPAC Name | 10-[25-(9-carboxynonanoyl)-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]-10-oxodecanoic acid |
| SMILES | O=C(O)CCCCCCCCC(=O)c1ccc2c(c1)OCCOCCOc1cc(C(=O)CCCCCCCCC(=O)O)ccc1OCCOCCO2 |
| InChI | InChI=1S/C40H56O12/c41-33(13-9-5-1-3-7-11-15-39(43)44)31-17-19-35-37(29-31)51-27-23-48-24-28-52-38-30-32(18-20-36(38)50-26-22-47-21-25-49-35)34(42)14-10-6-2-4-8-12-16-40(45)46/h17-20,29-30H,1-16,21-28H2,(H,43,44)(H,45,46) |
| InChIKey | VNPQUDLSANAVAO-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.88 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|