C15H21NO3 — CID 116551530
7-amino-1-(2,3-dihydro-1,4-benzodioxin-6-yl)heptan-1-one (PubChem CID 116551530) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 7-amino-1-(2,3-dihydro-1,4-benzodioxin-6-yl)heptan-1-one.
| Compound Name | 7-amino-1-(2,3-dihydro-1,4-benzodioxin-6-yl)heptan-1-one |
|---|---|
| PubChem CID | 116551530 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 7-amino-1-(2,3-dihydro-1,4-benzodioxin-6-yl)heptan-1-one |
| SMILES | NCCCCCCC(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H21NO3/c16-8-4-2-1-3-5-13(17)12-6-7-14-15(11-12)19-10-9-18-14/h6-7,11H,1-5,8-10,16H2 |
| InChIKey | XKAUTHOVJBHBKH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|