C35H38O8 — CID 175530623
1,3-bis(1,3-benzodioxol-5-yl)propane-1,3-dione;1-phenyldodecane-1,3-dione (PubChem CID 175530623) has the molecular formula C35H38O8 and a molecular weight of 586.68 g/mol. Its IUPAC name is 1,3-bis(1,3-benzodioxol-5-yl)propane-1,3-dione;1-phenyldodecane-1,3-dione.
| Compound Name | 1,3-bis(1,3-benzodioxol-5-yl)propane-1,3-dione;1-phenyldodecane-1,3-dione |
|---|---|
| PubChem CID | 175530623 |
| Molecular Formula | C35H38O8 |
| Molecular Weight | 586.68 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | 1,3-bis(1,3-benzodioxol-5-yl)propane-1,3-dione;1-phenyldodecane-1,3-dione |
| SMILES | CCCCCCCCCC(=O)CC(=O)c1ccccc1.O=C(CC(=O)c1ccc2c(c1)OCO2)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H26O2.C17H12O6/c1-2-3-4-5-6-7-11-14-17(19)15-18(20)16-12-9-8-10-13-16;18-12(10-1-3-14-16(5-10)22-8-20-14)7-13(19)11-2-4-15-17(6-11)23-9-21-15/h8-10,12-13H,2-7,11,14-15H2,1H3;1-6H,7-9H2 |
| InChIKey | LMFKURVWGOYLLC-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.68 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|