C20H19F2N3O3S — CID 56566421
1-[1-(3,4-difluorophenyl)ethyl]-3-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-1-methylurea (PubChem CID 56566421) has the molecular formula C20H19F2N3O3S and a molecular weight of 419.45 g/mol. Its IUPAC name is 1-[1-(3,4-difluorophenyl)ethyl]-3-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-1-methylurea.
| Compound Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-1-methylurea |
|---|---|
| PubChem CID | 56566421 |
| Molecular Formula | C20H19F2N3O3S |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-1-methylurea |
| SMILES | CC(c1ccc(F)c(F)c1)N(C)C(=O)Nc1ccc(CN2C(=O)CSC2=O)cc1 |
| InChI | InChI=1S/C20H19F2N3O3S/c1-12(14-5-8-16(21)17(22)9-14)24(2)19(27)23-15-6-3-13(4-7-15)10-25-18(26)11-29-20(25)28/h3-9,12H,10-11H2,1-2H3,(H,23,27) |
| InChIKey | QPHFIYIKLJSVRZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|