C17H19N3O5S — CID 122078680
1-[[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 122078680) has the molecular formula C17H19N3O5S and a molecular weight of 377.42 g/mol. Its IUPAC name is 1-[[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122078680 |
| Molecular Formula | C17H19N3O5S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 1-[[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(C(=O)Nc2ccc(CN3C(=O)CSC3=O)cc2)C1 |
| InChI | InChI=1S/C17H19N3O5S/c1-17(14(22)23)6-7-19(10-17)15(24)18-12-4-2-11(3-5-12)8-20-13(21)9-26-16(20)25/h2-5H,6-10H2,1H3,(H,18,24)(H,22,23) |
| InChIKey | XYUODKYVPZJCNU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|