C20H21N3O4 — CID 122078258
3-methyl-1-[[4-(phenylcarbamoyl)phenyl]carbamoyl]pyrrolidine-3-carboxylic acid (PubChem CID 122078258) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 3-methyl-1-[[4-(phenylcarbamoyl)phenyl]carbamoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 3-methyl-1-[[4-(phenylcarbamoyl)phenyl]carbamoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122078258 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 3-methyl-1-[[4-(phenylcarbamoyl)phenyl]carbamoyl]pyrrolidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(C(=O)Nc2ccc(C(=O)Nc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C20H21N3O4/c1-20(18(25)26)11-12-23(13-20)19(27)22-16-9-7-14(8-10-16)17(24)21-15-5-3-2-4-6-15/h2-10H,11-13H2,1H3,(H,21,24)(H,22,27)(H,25,26) |
| InChIKey | ITBDBMQNTDYHEK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |