C21H23N3O4 — CID 122076054
3-methyl-1-[[2-methyl-5-(phenylcarbamoyl)phenyl]carbamoyl]pyrrolidine-3-carboxylic acid (PubChem CID 122076054) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 3-methyl-1-[[2-methyl-5-(phenylcarbamoyl)phenyl]carbamoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 3-methyl-1-[[2-methyl-5-(phenylcarbamoyl)phenyl]carbamoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122076054 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 3-methyl-1-[[2-methyl-5-(phenylcarbamoyl)phenyl]carbamoyl]pyrrolidine-3-carboxylic acid |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2)cc1NC(=O)N1CCC(C)(C(=O)O)C1 |
| InChI | InChI=1S/C21H23N3O4/c1-14-8-9-15(18(25)22-16-6-4-3-5-7-16)12-17(14)23-20(28)24-11-10-21(2,13-24)19(26)27/h3-9,12H,10-11,13H2,1-2H3,(H,22,25)(H,23,28)(H,26,27) |
| InChIKey | FYOLZJYBUBAKLP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |