C18H25N3O4 — CID 122075361
1-[[4-(tert-butylcarbamoyl)phenyl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 122075361) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 1-[[4-(tert-butylcarbamoyl)phenyl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[[4-(tert-butylcarbamoyl)phenyl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122075361 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 1-[[4-(tert-butylcarbamoyl)phenyl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | CC(C)(C)NC(=O)c1ccc(NC(=O)N2CCC(C)(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C18H25N3O4/c1-17(2,3)20-14(22)12-5-7-13(8-6-12)19-16(25)21-10-9-18(4,11-21)15(23)24/h5-8H,9-11H2,1-4H3,(H,19,25)(H,20,22)(H,23,24) |
| InChIKey | LOCVLKCAYSUGPI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |