C19H19N3O5S — CID 56566227
1-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-3-[(3-hydroxy-4-methoxyphenyl)methyl]urea (PubChem CID 56566227) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is 1-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-3-[(3-hydroxy-4-methoxyphenyl)methyl]urea.
| Compound Name | 1-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-3-[(3-hydroxy-4-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 56566227 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 1-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-3-[(3-hydroxy-4-methoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CNC(=O)Nc2ccc(CN3C(=O)CSC3=O)cc2)cc1O |
| InChI | InChI=1S/C19H19N3O5S/c1-27-16-7-4-13(8-15(16)23)9-20-18(25)21-14-5-2-12(3-6-14)10-22-17(24)11-28-19(22)26/h2-8,23H,9-11H2,1H3,(H2,20,21,25) |
| InChIKey | XEKYJJVCYAZLGB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|