C20H19F2N3O3S — CID 56566267
1-[1-(2,6-difluorophenyl)propan-2-yl]-3-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]urea (PubChem CID 56566267) has the molecular formula C20H19F2N3O3S and a molecular weight of 419.45 g/mol. Its IUPAC name is 1-[1-(2,6-difluorophenyl)propan-2-yl]-3-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]urea.
| Compound Name | 1-[1-(2,6-difluorophenyl)propan-2-yl]-3-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 56566267 |
| Molecular Formula | C20H19F2N3O3S |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 1-[1-(2,6-difluorophenyl)propan-2-yl]-3-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]urea |
| SMILES | CC(Cc1c(F)cccc1F)NC(=O)Nc1ccc(CN2C(=O)CSC2=O)cc1 |
| InChI | InChI=1S/C20H19F2N3O3S/c1-12(9-15-16(21)3-2-4-17(15)22)23-19(27)24-14-7-5-13(6-8-14)10-25-18(26)11-29-20(25)28/h2-8,12H,9-11H2,1H3,(H2,23,24,27) |
| InChIKey | OOZSWKCYJNSDOO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|