C20H20FN3O3S2 — CID 56566514
1-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]urea (PubChem CID 56566514) has the molecular formula C20H20FN3O3S2 and a molecular weight of 433.53 g/mol. Its IUPAC name is 1-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]urea.
| Compound Name | 1-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]urea |
|---|---|
| PubChem CID | 56566514 |
| Molecular Formula | C20H20FN3O3S2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 1-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]urea |
| SMILES | O=C(NCCCSc1ccc(F)cc1)Nc1ccc(CN2C(=O)CSC2=O)cc1 |
| InChI | InChI=1S/C20H20FN3O3S2/c21-15-4-8-17(9-5-15)28-11-1-10-22-19(26)23-16-6-2-14(3-7-16)12-24-18(25)13-29-20(24)27/h2-9H,1,10-13H2,(H2,22,23,26) |
| InChIKey | SMPJRUAQPGNVRK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|