C22H26FN3O2S — CID 60614368
1-[3-(4-fluorophenyl)sulfanylpropyl]-3-[3-[(2-oxopiperidin-1-yl)methyl]phenyl]urea (PubChem CID 60614368) has the molecular formula C22H26FN3O2S and a molecular weight of 415.53 g/mol. Its IUPAC name is 1-[3-(4-fluorophenyl)sulfanylpropyl]-3-[3-[(2-oxopiperidin-1-yl)methyl]phenyl]urea.
| Compound Name | 1-[3-(4-fluorophenyl)sulfanylpropyl]-3-[3-[(2-oxopiperidin-1-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 60614368 |
| Molecular Formula | C22H26FN3O2S |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 1-[3-(4-fluorophenyl)sulfanylpropyl]-3-[3-[(2-oxopiperidin-1-yl)methyl]phenyl]urea |
| SMILES | O=C(NCCCSc1ccc(F)cc1)Nc1cccc(CN2CCCCC2=O)c1 |
| InChI | InChI=1S/C22H26FN3O2S/c23-18-8-10-20(11-9-18)29-14-4-12-24-22(28)25-19-6-3-5-17(15-19)16-26-13-2-1-7-21(26)27/h3,5-6,8-11,15H,1-2,4,7,12-14,16H2,(H2,24,25,28) |
| InChIKey | IUHLCQLQLVTDAZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|