C27H25N3O2 — CID 112825436
1-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-[3-(2-phenylethynyl)phenyl]urea (PubChem CID 112825436) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 1-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-[3-(2-phenylethynyl)phenyl]urea.
| Compound Name | 1-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-[3-(2-phenylethynyl)phenyl]urea |
|---|---|
| PubChem CID | 112825436 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 1-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-[3-(2-phenylethynyl)phenyl]urea |
| SMILES | O=C(NCc1cccc(CN2CCCC2=O)c1)Nc1cccc(C#Cc2ccccc2)c1 |
| InChI | InChI=1S/C27H25N3O2/c31-26-13-6-16-30(26)20-24-11-4-10-23(17-24)19-28-27(32)29-25-12-5-9-22(18-25)15-14-21-7-2-1-3-8-21/h1-5,7-12,17-18H,6,13,16,19-20H2,(H2,28,29,32) |
| InChIKey | SPJNKKLEHUOMFI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|