C24H20N2O3 — CID 112825404
1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-[3-(2-phenylethynyl)phenyl]urea (PubChem CID 112825404) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-[3-(2-phenylethynyl)phenyl]urea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-[3-(2-phenylethynyl)phenyl]urea |
|---|---|
| PubChem CID | 112825404 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-[3-(2-phenylethynyl)phenyl]urea |
| SMILES | O=C(NCc1ccc2c(c1)OCCO2)Nc1cccc(C#Cc2ccccc2)c1 |
| InChI | InChI=1S/C24H20N2O3/c27-24(25-17-20-11-12-22-23(16-20)29-14-13-28-22)26-21-8-4-7-19(15-21)10-9-18-5-2-1-3-6-18/h1-8,11-12,15-16H,13-14,17H2,(H2,25,26,27) |
| InChIKey | MMZKNLZZRYNRPY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|