C15H13ClN2O3S — CID 142259772
[3-(1,3-benzodioxol-5-ylmethylcarbamoylamino)phenyl] thiohypochlorite (PubChem CID 142259772) has the molecular formula C15H13ClN2O3S and a molecular weight of 336.80 g/mol. Its IUPAC name is [3-(1,3-benzodioxol-5-ylmethylcarbamoylamino)phenyl] thiohypochlorite.
| Compound Name | [3-(1,3-benzodioxol-5-ylmethylcarbamoylamino)phenyl] thiohypochlorite |
|---|---|
| PubChem CID | 142259772 |
| Molecular Formula | C15H13ClN2O3S |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | [3-(1,3-benzodioxol-5-ylmethylcarbamoylamino)phenyl] thiohypochlorite |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)Nc1cccc(SCl)c1 |
| InChI | InChI=1S/C15H13ClN2O3S/c16-22-12-3-1-2-11(7-12)18-15(19)17-8-10-4-5-13-14(6-10)21-9-20-13/h1-7H,8-9H2,(H2,17,18,19) |
| InChIKey | YOWZUCZRIGXZOU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |