C18H16N4O3 — CID 51116793
1-(1,3-benzodioxol-5-ylmethyl)-3-(3-pyrazol-1-ylphenyl)urea (PubChem CID 51116793) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-(3-pyrazol-1-ylphenyl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(3-pyrazol-1-ylphenyl)urea |
|---|---|
| PubChem CID | 51116793 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(3-pyrazol-1-ylphenyl)urea |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)Nc1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C18H16N4O3/c23-18(19-11-13-5-6-16-17(9-13)25-12-24-16)21-14-3-1-4-15(10-14)22-8-2-7-20-22/h1-10H,11-12H2,(H2,19,21,23) |
| InChIKey | BUDOFNVIMAOZII-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |