C20H28N4O3 — CID 128960283
1-(1-acetylpiperidin-4-yl)-3-[3-[(2-oxopiperidin-1-yl)methyl]phenyl]urea (PubChem CID 128960283) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-(1-acetylpiperidin-4-yl)-3-[3-[(2-oxopiperidin-1-yl)methyl]phenyl]urea.
| Compound Name | 1-(1-acetylpiperidin-4-yl)-3-[3-[(2-oxopiperidin-1-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 128960283 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 1-(1-acetylpiperidin-4-yl)-3-[3-[(2-oxopiperidin-1-yl)methyl]phenyl]urea |
| SMILES | CC(=O)N1CCC(NC(=O)Nc2cccc(CN3CCCCC3=O)c2)CC1 |
| InChI | InChI=1S/C20H28N4O3/c1-15(25)23-11-8-17(9-12-23)21-20(27)22-18-6-4-5-16(13-18)14-24-10-3-2-7-19(24)26/h4-6,13,17H,2-3,7-12,14H2,1H3,(H2,21,22,27) |
| InChIKey | HXVNMSORRPNLEC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |