C24H25FN6O2 — CID 154837502
1-[3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-3-[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]urea (PubChem CID 154837502) has the molecular formula C24H25FN6O2 and a molecular weight of 448.50 g/mol. Its IUPAC name is 1-[3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-3-[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]urea.
| Compound Name | 1-[3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-3-[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 154837502 |
| Molecular Formula | C24H25FN6O2 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 1-[3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-3-[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]urea |
| SMILES | O=C(Nc1cccc(CN2CCCC2=O)c1)NC1CCc2nnc(-c3ccc(F)cc3)n2C1 |
| InChI | InChI=1S/C24H25FN6O2/c25-18-8-6-17(7-9-18)23-29-28-21-11-10-20(15-31(21)23)27-24(33)26-19-4-1-3-16(13-19)14-30-12-2-5-22(30)32/h1,3-4,6-9,13,20H,2,5,10-12,14-15H2,(H2,26,27,33) |
| InChIKey | FSXZSYVYHUEIFT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |