C17H20FN5O2 — CID 97346653
N-[(6R)-3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]morpholine-4-carboxamide (PubChem CID 97346653) has the molecular formula C17H20FN5O2 and a molecular weight of 345.38 g/mol. Its IUPAC name is N-[(6R)-3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]morpholine-4-carboxamide.
| Compound Name | N-[(6R)-3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 97346653 |
| Molecular Formula | C17H20FN5O2 |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-[(6R)-3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]morpholine-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCc2nnc(-c3ccc(F)cc3)n2C1)N1CCOCC1 |
| InChI | InChI=1S/C17H20FN5O2/c18-13-3-1-12(2-4-13)16-21-20-15-6-5-14(11-23(15)16)19-17(24)22-7-9-25-10-8-22/h1-4,14H,5-11H2,(H,19,24)/t14-/m1/s1 |
| InChIKey | BTHPJRIJDSPNQB-CQSZACIVSA-N |
| XLogP | 1.44 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |