C15H20N2O2 — CID 115599477
N-(1,2,3,4-tetrahydronaphthalen-2-yl)morpholine-4-carboxamide (PubChem CID 115599477) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydronaphthalen-2-yl)morpholine-4-carboxamide.
| Compound Name | N-(1,2,3,4-tetrahydronaphthalen-2-yl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 115599477 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-(1,2,3,4-tetrahydronaphthalen-2-yl)morpholine-4-carboxamide |
| SMILES | O=C(NC1CCc2ccccc2C1)N1CCOCC1 |
| InChI | InChI=1S/C15H20N2O2/c18-15(17-7-9-19-10-8-17)16-14-6-5-12-3-1-2-4-13(12)11-14/h1-4,14H,5-11H2,(H,16,18) |
| InChIKey | ACNZLXXDBFXIIM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |