C16H22N2O — CID 104694688
N-(2,3-dihydro-1H-inden-2-yl)-4-methylpiperidine-1-carboxamide (PubChem CID 104694688) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)-4-methylpiperidine-1-carboxamide.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)-4-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 104694688 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)-4-methylpiperidine-1-carboxamide |
| SMILES | CC1CCN(C(=O)NC2Cc3ccccc3C2)CC1 |
| InChI | InChI=1S/C16H22N2O/c1-12-6-8-18(9-7-12)16(19)17-15-10-13-4-2-3-5-14(13)11-15/h2-5,12,15H,6-11H2,1H3,(H,17,19) |
| InChIKey | NKNZQBYVCDSIGZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |